C30H26N2O8 — CID 20594830
[4,5-bis(2-methylprop-2-enoylamino)-8-(2-methylprop-2-enoyloxy)-9,10-dioxoanthracen-1-yl] 2-methylprop-2-enoate (PubChem CID 20594830) has the molecular formula C30H26N2O8 and a molecular weight of 542.54 g/mol. Its IUPAC name is [4,5-bis(2-methylprop-2-enoylamino)-8-(2-methylprop-2-enoyloxy)-9,10-dioxoanthracen-1-yl] 2-methylprop-2-enoate.
| Compound Name | [4,5-bis(2-methylprop-2-enoylamino)-8-(2-methylprop-2-enoyloxy)-9,10-dioxoanthracen-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20594830 |
| Molecular Formula | C30H26N2O8 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | [4,5-bis(2-methylprop-2-enoylamino)-8-(2-methylprop-2-enoyloxy)-9,10-dioxoanthracen-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Nc1ccc(OC(=O)C(=C)C)c2c1C(=O)c1c(NC(=O)C(=C)C)ccc(OC(=O)C(=C)C)c1C2=O |
| InChI | InChI=1S/C30H26N2O8/c1-13(2)27(35)31-17-9-11-19(39-29(37)15(5)6)23-21(17)25(33)22-18(32-28(36)14(3)4)10-12-20(24(22)26(23)34)40-30(38)16(7)8/h9-12H,1,3,5,7H2,2,4,6,8H3,(H,31,35)(H,32,36) |
| InChIKey | JIDHSQMMEHMYAP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|