C22H26N2O8 — CID 102267424
1,5-dihydroxy-4,8-bis[(2-hydroxy-3-methoxypropyl)amino]anthracene-9,10-dione (PubChem CID 102267424) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1,5-dihydroxy-4,8-bis[(2-hydroxy-3-methoxypropyl)amino]anthracene-9,10-dione.
| Compound Name | 1,5-dihydroxy-4,8-bis[(2-hydroxy-3-methoxypropyl)amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 102267424 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1,5-dihydroxy-4,8-bis[(2-hydroxy-3-methoxypropyl)amino]anthracene-9,10-dione |
| SMILES | COCC(O)CNc1ccc(O)c2c1C(=O)c1c(O)ccc(NCC(O)COC)c1C2=O |
| InChI | InChI=1S/C22H26N2O8/c1-31-9-11(25)7-23-13-3-5-15(27)19-17(13)21(29)20-16(28)6-4-14(18(20)22(19)30)24-8-12(26)10-32-2/h3-6,11-12,23-28H,7-10H2,1-2H3 |
| InChIKey | MZTRTHMHMWCKSG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|