C20H21NO5 — CID 10247608
1-(2,2-diethoxyethylamino)-4-hydroxyanthracene-9,10-dione (PubChem CID 10247608) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-(2,2-diethoxyethylamino)-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-(2,2-diethoxyethylamino)-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 10247608 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-(2,2-diethoxyethylamino)-4-hydroxyanthracene-9,10-dione |
| SMILES | CCOC(CNc1ccc(O)c2c1C(=O)c1ccccc1C2=O)OCC |
| InChI | InChI=1S/C20H21NO5/c1-3-25-16(26-4-2)11-21-14-9-10-15(22)18-17(14)19(23)12-7-5-6-8-13(12)20(18)24/h5-10,16,21-22H,3-4,11H2,1-2H3 |
| InChIKey | AOWKZBZUEQGKIJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|