C28H22N2O6 — CID 154095434
1,4-bis[(2,5-dihydroxyphenyl)methylamino]anthracene-9,10-dione (PubChem CID 154095434) has the molecular formula C28H22N2O6 and a molecular weight of 482.49 g/mol. Its IUPAC name is 1,4-bis[(2,5-dihydroxyphenyl)methylamino]anthracene-9,10-dione.
| Compound Name | 1,4-bis[(2,5-dihydroxyphenyl)methylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 154095434 |
| Molecular Formula | C28H22N2O6 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1,4-bis[(2,5-dihydroxyphenyl)methylamino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCc3cc(O)ccc3O)ccc(NCc3cc(O)ccc3O)c21 |
| InChI | InChI=1S/C28H22N2O6/c31-17-5-9-23(33)15(11-17)13-29-21-7-8-22(30-14-16-12-18(32)6-10-24(16)34)26-25(21)27(35)19-3-1-2-4-20(19)28(26)36/h1-12,29-34H,13-14H2 |
| InChIKey | FASLVZNYESDWCY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|