C17H18ClNO4 — CID 66692967
2-chloro-4-[(2,5-dihydroxyphenyl)methylamino]-3-propan-2-ylbenzoic acid (PubChem CID 66692967) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-chloro-4-[(2,5-dihydroxyphenyl)methylamino]-3-propan-2-ylbenzoic acid.
| Compound Name | 2-chloro-4-[(2,5-dihydroxyphenyl)methylamino]-3-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 66692967 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-chloro-4-[(2,5-dihydroxyphenyl)methylamino]-3-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1c(NCc2cc(O)ccc2O)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C17H18ClNO4/c1-9(2)15-13(5-4-12(16(15)18)17(22)23)19-8-10-7-11(20)3-6-14(10)21/h3-7,9,19-21H,8H2,1-2H3,(H,22,23) |
| InChIKey | JMTLYCYMMYSMMY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|