C18H17NO5 — CID 135183207
1-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]anthracene-9,10-dione (PubChem CID 135183207) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]anthracene-9,10-dione.
| Compound Name | 1-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 135183207 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCOCCO)ccc(O)c21 |
| InChI | InChI=1S/C18H17NO5/c20-8-10-24-9-7-19-13-5-6-14(21)16-15(13)17(22)11-3-1-2-4-12(11)18(16)23/h1-6,19-21H,7-10H2 |
| InChIKey | SXGWPEXFWBUDHE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|