About N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide
N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide (PubChem CID 71188680) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide.
Molecular Properties
| Compound Name | N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide |
| PubChem CID | 71188680 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide |
| SMILES | CCCC(=O)NCCNc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H20N2O4/c1-2-5-16(24)22-11-10-21-14-8-9-15(23)18-17(14)19(25)12-6-3-4-7-13(12)20(18)26/h3-4,6-9,21,23H,2,5,10-11H2,1H3,(H,22,24) |
| InChIKey | LFYNUUPGPTZAGL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide?
The IUPAC name of N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide (CID 71188680) is N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide.
What is the SMILES notation for N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide?
The canonical SMILES for N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide is CCCC(=O)NCCNc1ccc(O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide?
The InChIKey is LFYNUUPGPTZAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c1-2-5-16(24)22-11-10-21-14-8-9-15(23)18-17(14)19(25)12-6-3-4-7-13(12)20(18)26/h3-4,6-9,21,23H,2,5,10-11H2,1H3,(H,22,24).
What are the key properties of N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide?
N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide has a molecular weight of 352.39 g/mol, XLogP of 2.50, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]ethyl]butanamide is sourced from PubChem (CID 71188680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).