C19H20N2O5 — CID 19751123
1-(2,3-dihydroxypropylamino)-4-(2-hydroxyethylamino)anthracene-9,10-dione (PubChem CID 19751123) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropylamino)-4-(2-hydroxyethylamino)anthracene-9,10-dione.
| Compound Name | 1-(2,3-dihydroxypropylamino)-4-(2-hydroxyethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 19751123 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(2,3-dihydroxypropylamino)-4-(2-hydroxyethylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCC(O)CO)ccc(NCCO)c21 |
| InChI | InChI=1S/C19H20N2O5/c22-8-7-20-14-5-6-15(21-9-11(24)10-23)17-16(14)18(25)12-3-1-2-4-13(12)19(17)26/h1-6,11,20-24H,7-10H2 |
| InChIKey | XYMLXYQBTQFPME-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|