C17H13Br2NO4 — CID 168594053
2,4-dibromo-1-(2,3-dihydroxypropylamino)anthracene-9,10-dione (PubChem CID 168594053) has the molecular formula C17H13Br2NO4 and a molecular weight of 455.10 g/mol. Its IUPAC name is 2,4-dibromo-1-(2,3-dihydroxypropylamino)anthracene-9,10-dione.
| Compound Name | 2,4-dibromo-1-(2,3-dihydroxypropylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 168594053 |
| Molecular Formula | C17H13Br2NO4 |
| Molecular Weight | 455.10 g/mol |
| Exact Mass | 452.92 |
| IUPAC Name | 2,4-dibromo-1-(2,3-dihydroxypropylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCC(O)CO)c(Br)cc(Br)c21 |
| InChI | InChI=1S/C17H13Br2NO4/c18-11-5-12(19)15(20-6-8(22)7-21)14-13(11)16(23)9-3-1-2-4-10(9)17(14)24/h1-5,8,20-22H,6-7H2 |
| InChIKey | DYYIJFOOOXLVAF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.10 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|