C16H9BrF3NO3 — CID 154383306
2-bromo-4-hydroxy-1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione (PubChem CID 154383306) has the molecular formula C16H9BrF3NO3 and a molecular weight of 400.15 g/mol. Its IUPAC name is 2-bromo-4-hydroxy-1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione.
| Compound Name | 2-bromo-4-hydroxy-1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 154383306 |
| Molecular Formula | C16H9BrF3NO3 |
| Molecular Weight | 400.15 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 2-bromo-4-hydroxy-1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCC(F)(F)F)c(Br)cc(O)c21 |
| InChI | InChI=1S/C16H9BrF3NO3/c17-9-5-10(22)11-12(13(9)21-6-16(18,19)20)15(24)8-4-2-1-3-7(8)14(11)23/h1-5,21-22H,6H2 |
| InChIKey | JGBLCIWRHCYDPS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|