C24H19Br2NO5 — CID 71022140
1-[2,6-dibromo-4-[2-(1-hydroxyethoxy)ethyl]anilino]-4-hydroxyanthracene-9,10-dione (PubChem CID 71022140) has the molecular formula C24H19Br2NO5 and a molecular weight of 561.23 g/mol. Its IUPAC name is 1-[2,6-dibromo-4-[2-(1-hydroxyethoxy)ethyl]anilino]-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-[2,6-dibromo-4-[2-(1-hydroxyethoxy)ethyl]anilino]-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 71022140 |
| Molecular Formula | C24H19Br2NO5 |
| Molecular Weight | 561.23 g/mol |
| Exact Mass | 558.96 |
| IUPAC Name | 1-[2,6-dibromo-4-[2-(1-hydroxyethoxy)ethyl]anilino]-4-hydroxyanthracene-9,10-dione |
| SMILES | CC(O)OCCc1cc(Br)c(Nc2ccc(O)c3c2C(=O)c2ccccc2C3=O)c(Br)c1 |
| InChI | InChI=1S/C24H19Br2NO5/c1-12(28)32-9-8-13-10-16(25)22(17(26)11-13)27-18-6-7-19(29)21-20(18)23(30)14-4-2-3-5-15(14)24(21)31/h2-7,10-12,27-29H,8-9H2,1H3 |
| InChIKey | WKFQDSYXQWBVCM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|