C24H17Br2NO5 — CID 23526031
2-[3,5-dibromo-4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl acetate (PubChem CID 23526031) has the molecular formula C24H17Br2NO5 and a molecular weight of 559.21 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl acetate.
| Compound Name | 2-[3,5-dibromo-4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl acetate |
|---|---|
| PubChem CID | 23526031 |
| Molecular Formula | C24H17Br2NO5 |
| Molecular Weight | 559.21 g/mol |
| Exact Mass | 556.95 |
| IUPAC Name | 2-[3,5-dibromo-4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl acetate |
| SMILES | CC(=O)OCCc1cc(Br)c(Nc2ccc(O)c3c2C(=O)c2ccccc2C3=O)c(Br)c1 |
| InChI | InChI=1S/C24H17Br2NO5/c1-12(28)32-9-8-13-10-16(25)22(17(26)11-13)27-18-6-7-19(29)21-20(18)23(30)14-4-2-3-5-15(14)24(21)31/h2-7,10-11,27,29H,8-9H2,1H3 |
| InChIKey | OCOWQYNDYBHBKK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.21 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|