C21H22N2O5 — CID 146220228
tert-butyl 2-amino-2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propanoate (PubChem CID 146220228) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propanoate.
| Compound Name | tert-butyl 2-amino-2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propanoate |
|---|---|
| PubChem CID | 146220228 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | tert-butyl 2-amino-2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(N)Nc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H22N2O5/c1-20(2,3)28-19(27)21(4,22)23-13-9-10-14(24)16-15(13)17(25)11-7-5-6-8-12(11)18(16)26/h5-10,23-24H,22H2,1-4H3 |
| InChIKey | HSXTTZSYNUUNPY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|