C31H32N2O8 — CID 54377200
3-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 54377200) has the molecular formula C31H32N2O8 and a molecular weight of 560.60 g/mol. Its IUPAC name is 3-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 3-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 54377200 |
| Molecular Formula | C31H32N2O8 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 3-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OCCCNc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H32N2O8/c1-31(2,3)41-30(39)33-23(17-18-9-11-19(34)12-10-18)29(38)40-16-6-15-32-22-13-14-24(35)26-25(22)27(36)20-7-4-5-8-21(20)28(26)37/h4-5,7-14,23,32,34-35H,6,15-17H2,1-3H3,(H,33,39)/t23-/m0/s1 |
| InChIKey | UXJCNDLCZLMGPE-QHCPKHFHSA-N |
| XLogP | 4.35 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|