C27H32N2O6 — CID 54198656
3-[(9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 54198656) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3-[(9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 3-[(9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 54198656 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 3-[(9,10-dioxoanthracen-1-yl)amino]propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCCNc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H32N2O6/c1-16(2)22(29-26(33)35-27(3,4)5)25(32)34-15-9-14-28-20-13-8-12-19-21(20)24(31)18-11-7-6-10-17(18)23(19)30/h6-8,10-13,16,22,28H,9,14-15H2,1-5H3,(H,29,33)/t22-/m0/s1 |
| InChIKey | PNQOUDBPXAQBQF-QFIPXVFZSA-N |
| XLogP | 4.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|