C24H32N2O7 — CID 166957872
(1,3-dioxoinden-2-yl) (2S)-3-methyl-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]butanoate (PubChem CID 166957872) has the molecular formula C24H32N2O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is (1,3-dioxoinden-2-yl) (2S)-3-methyl-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]butanoate.
| Compound Name | (1,3-dioxoinden-2-yl) (2S)-3-methyl-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 166957872 |
| Molecular Formula | C24H32N2O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (1,3-dioxoinden-2-yl) (2S)-3-methyl-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](C(=O)OC1C(=O)c2ccccc2C1=O)C(C)C |
| InChI | InChI=1S/C24H32N2O7/c1-12(2)16(26-23(31)33-24(5,6)7)21(29)25-17(13(3)4)22(30)32-20-18(27)14-10-8-9-11-15(14)19(20)28/h8-13,16-17,20H,1-7H3,(H,25,29)(H,26,31)/t16-,17-/m0/s1 |
| InChIKey | KQIQULVOQIHSQA-IRXDYDNUSA-N |
| XLogP | 2.67 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|