C18H22N2O4S — CID 10808634
tert-butyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-methyl-1-sulfanylidenebutan-2-yl]carbamate (PubChem CID 10808634) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-methyl-1-sulfanylidenebutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-methyl-1-sulfanylidenebutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10808634 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-methyl-1-sulfanylidenebutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=S)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22N2O4S/c1-10(2)13(19-17(23)24-18(3,4)5)16(25)20-14(21)11-8-6-7-9-12(11)15(20)22/h6-10,13H,1-5H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | CBCRLKWNWPLTQT-ZDUSSCGKSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|