C26H30N2O7 — CID 56987623
2-[2-[(9,10-dioxoanthracen-1-yl)amino]ethoxy]ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 56987623) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is 2-[2-[(9,10-dioxoanthracen-1-yl)amino]ethoxy]ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 2-[2-[(9,10-dioxoanthracen-1-yl)amino]ethoxy]ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 56987623 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[2-[(9,10-dioxoanthracen-1-yl)amino]ethoxy]ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)OCCOCCNc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H30N2O7/c1-16(28-25(32)35-26(2,3)4)24(31)34-15-14-33-13-12-27-20-11-7-10-19-21(20)23(30)18-9-6-5-8-17(18)22(19)29/h5-11,16,27H,12-15H2,1-4H3,(H,28,32)/t16-/m1/s1 |
| InChIKey | DIGZXJIUKOMFEH-MRXNPFEDSA-N |
| XLogP | 3.35 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|