C31H33N3O5 — CID 67637101
tert-butyl N-[(2R)-2-amino-3-phenylpropanoyl]-N-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]carbamate (PubChem CID 67637101) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-amino-3-phenylpropanoyl]-N-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-amino-3-phenylpropanoyl]-N-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 67637101 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | tert-butyl N-[(2R)-2-amino-3-phenylpropanoyl]-N-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNc1cccc2c1C(=O)c1ccccc1C2=O)C(=O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C31H33N3O5/c1-31(2,3)39-30(38)34(29(37)24(32)19-20-11-5-4-6-12-20)18-10-17-33-25-16-9-15-23-26(25)28(36)22-14-8-7-13-21(22)27(23)35/h4-9,11-16,24,33H,10,17-19,32H2,1-3H3/t24-/m1/s1 |
| InChIKey | VIRFOZWPXNBVGI-XMMPIXPASA-N |
| XLogP | 4.60 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|