C36H40N2O7 — CID 11801894
ditert-butyl 2-[[4-[4-[(9,10-dioxoanthracen-1-yl)amino]butanoylamino]phenyl]methyl]propanedioate (PubChem CID 11801894) has the molecular formula C36H40N2O7 and a molecular weight of 612.72 g/mol. Its IUPAC name is ditert-butyl 2-[[4-[4-[(9,10-dioxoanthracen-1-yl)amino]butanoylamino]phenyl]methyl]propanedioate.
| Compound Name | ditert-butyl 2-[[4-[4-[(9,10-dioxoanthracen-1-yl)amino]butanoylamino]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 11801894 |
| Molecular Formula | C36H40N2O7 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | ditert-butyl 2-[[4-[4-[(9,10-dioxoanthracen-1-yl)amino]butanoylamino]phenyl]methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(NC(=O)CCCNc2cccc3c2C(=O)c2ccccc2C3=O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H40N2O7/c1-35(2,3)44-33(42)27(34(43)45-36(4,5)6)21-22-16-18-23(19-17-22)38-29(39)15-10-20-37-28-14-9-13-26-30(28)32(41)25-12-8-7-11-24(25)31(26)40/h7-9,11-14,16-19,27,37H,10,15,20-21H2,1-6H3,(H,38,39) |
| InChIKey | PKLJWPBICMHFHV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|