C20H17NO4 — CID 67954355
ethyl (E)-4-[(9,10-dioxoanthracen-1-yl)amino]but-2-enoate (PubChem CID 67954355) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl (E)-4-[(9,10-dioxoanthracen-1-yl)amino]but-2-enoate.
| Compound Name | ethyl (E)-4-[(9,10-dioxoanthracen-1-yl)amino]but-2-enoate |
|---|---|
| PubChem CID | 67954355 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | ethyl (E)-4-[(9,10-dioxoanthracen-1-yl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H17NO4/c1-2-25-17(22)11-6-12-21-16-10-5-9-15-18(16)20(24)14-8-4-3-7-13(14)19(15)23/h3-11,21H,2,12H2,1H3/b11-6+ |
| InChIKey | YCCLBFFCMYKLPJ-IZZDOVSWSA-N |
| XLogP | 2.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|