C25H17NO5 — CID 3692079
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-phenylprop-2-enoate (PubChem CID 3692079) has the molecular formula C25H17NO5 and a molecular weight of 411.41 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-phenylprop-2-enoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3692079 |
| Molecular Formula | C25H17NO5 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccccc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H17NO5/c27-21(15-31-22(28)14-13-16-7-2-1-3-8-16)26-20-12-6-11-19-23(20)25(30)18-10-5-4-9-17(18)24(19)29/h1-14H,15H2,(H,26,27) |
| InChIKey | JNIWRPRGXRMRDM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|