C23H14BrNO5 — CID 3678328
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-bromobenzoate (PubChem CID 3678328) has the molecular formula C23H14BrNO5 and a molecular weight of 464.27 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-bromobenzoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 3678328 |
| Molecular Formula | C23H14BrNO5 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 3-bromobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Br)c1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H14BrNO5/c24-14-6-3-5-13(11-14)23(29)30-12-19(26)25-18-10-4-9-17-20(18)22(28)16-8-2-1-7-15(16)21(17)27/h1-11H,12H2,(H,25,26) |
| InChIKey | PVTBGYDOKGSIPU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|