C24H15NO7 — CID 4692428
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 4692428) has the molecular formula C24H15NO7 and a molecular weight of 429.38 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 4692428 |
| Molecular Formula | C24H15NO7 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)OCO2)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H15NO7/c26-20(11-30-24(29)13-8-9-18-19(10-13)32-12-31-18)25-17-7-3-6-16-21(17)23(28)15-5-2-1-4-14(15)22(16)27/h1-10H,11-12H2,(H,25,26) |
| InChIKey | RGGKYTRBMDDXOJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|