C25H17NO7 — CID 3683273
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 3683273) has the molecular formula C25H17NO7 and a molecular weight of 443.41 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 3683273 |
| Molecular Formula | C25H17NO7 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)OCCO2)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H17NO7/c27-21(13-33-25(30)14-8-9-19-20(12-14)32-11-10-31-19)26-18-7-3-6-17-22(18)24(29)16-5-2-1-4-15(16)23(17)28/h1-9,12H,10-11,13H2,(H,26,27) |
| InChIKey | FVHQTIFDWWPUMG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|