C24H17NO6 — CID 7871910
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate (PubChem CID 7871910) has the molecular formula C24H17NO6 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 7871910 |
| Molecular Formula | C24H17NO6 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(CO)cc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H17NO6/c26-12-14-8-10-15(11-9-14)24(30)31-13-20(27)25-19-7-3-6-18-21(19)23(29)17-5-2-1-4-16(17)22(18)28/h1-11,26H,12-13H2,(H,25,27) |
| InChIKey | UAZKJXVUBMPJEX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|