C23H15NO7 — CID 18162351
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 18162351) has the molecular formula C23H15NO7 and a molecular weight of 417.37 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 18162351 |
| Molecular Formula | C23H15NO7 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H15NO7/c25-12-8-9-15(18(26)10-12)23(30)31-11-19(27)24-17-7-3-6-16-20(17)22(29)14-5-2-1-4-13(14)21(16)28/h1-10,25-26H,11H2,(H,24,27) |
| InChIKey | LXISUFZBERLIAV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|