C16H14ClNO5 — CID 2536642
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 2536642) has the molecular formula C16H14ClNO5 and a molecular weight of 335.74 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 2536642 |
| Molecular Formula | C16H14ClNO5 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H14ClNO5/c1-9-12(17)3-2-4-13(9)18-15(21)8-23-16(22)11-6-5-10(19)7-14(11)20/h2-7,19-20H,8H2,1H3,(H,18,21) |
| InChIKey | HHBRKIQGKICWON-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |