C24H18F3NO3 — CID 29142790
[2-oxo-2-(2-phenylanilino)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 29142790) has the molecular formula C24H18F3NO3 and a molecular weight of 425.41 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylanilino)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(2-phenylanilino)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 29142790 |
| Molecular Formula | C24H18F3NO3 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [2-oxo-2-(2-phenylanilino)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc(C(F)(F)F)c1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H18F3NO3/c25-24(26,27)19-10-6-7-17(15-19)13-14-23(30)31-16-22(29)28-21-12-5-4-11-20(21)18-8-2-1-3-9-18/h1-15H,16H2,(H,28,29)/b14-13+ |
| InChIKey | JVEXJOSRGZMMJI-BUHFOSPRSA-N |
| XLogP | 5.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|