C19H12ClF3N2O3 — CID 7967768
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7967768) has the molecular formula C19H12ClF3N2O3 and a molecular weight of 408.76 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7967768 |
| Molecular Formula | C19H12ClF3N2O3 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12ClF3N2O3/c20-15-6-5-13(10-24)16(9-15)25-17(26)11-28-18(27)7-4-12-2-1-3-14(8-12)19(21,22)23/h1-9H,11H2,(H,25,26)/b7-4+ |
| InChIKey | MNPUDLGWVKSRJR-QPJJXVBHSA-N |
| XLogP | 4.43 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|