C29H29N3O3 — CID 11757964
(2R)-2-amino-N-[4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]-3-phenylpropanamide (PubChem CID 11757964) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-amino-N-[4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 11757964 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (2R)-2-amino-N-[4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]-3-phenylpropanamide |
| SMILES | N[C@H](Cc1ccccc1)C(=O)NC1CCC(Nc2cccc3c2C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C29H29N3O3/c30-24(17-18-7-2-1-3-8-18)29(35)32-20-15-13-19(14-16-20)31-25-12-6-11-23-26(25)28(34)22-10-5-4-9-21(22)27(23)33/h1-12,19-20,24,31H,13-17,30H2,(H,32,35)/t19?,20?,24-/m1/s1 |
| InChIKey | PXATYVGBUYJBBH-ZSHKSDETSA-N |
| XLogP | 3.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|