C23H25N3O3 — CID 91188050
N-[(2R)-2-amino-4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]propanamide (PubChem CID 91188050) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[(2R)-2-amino-4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]propanamide.
| Compound Name | N-[(2R)-2-amino-4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 91188050 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[(2R)-2-amino-4-[(9,10-dioxoanthracen-1-yl)amino]cyclohexyl]propanamide |
| SMILES | CCC(=O)NC1CCC(Nc2cccc3c2C(=O)c2ccccc2C3=O)C[C@H]1N |
| InChI | InChI=1S/C23H25N3O3/c1-2-20(27)26-18-11-10-13(12-17(18)24)25-19-9-5-8-16-21(19)23(29)15-7-4-3-6-14(15)22(16)28/h3-9,13,17-18,25H,2,10-12,24H2,1H3,(H,26,27)/t13?,17-,18?/m1/s1 |
| InChIKey | WXIFGNYFGXYQLX-LKGZKJKYSA-N |
| XLogP | 2.65 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|