C22H23N3O3 — CID 154286622
N-[4-[(4-amino-9,10-dioxoanthracen-1-yl)amino]cyclohexyl]acetamide (PubChem CID 154286622) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[4-[(4-amino-9,10-dioxoanthracen-1-yl)amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[(4-amino-9,10-dioxoanthracen-1-yl)amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 154286622 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[4-[(4-amino-9,10-dioxoanthracen-1-yl)amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C22H23N3O3/c1-12(26)24-13-6-8-14(9-7-13)25-18-11-10-17(23)19-20(18)22(28)16-5-3-2-4-15(16)21(19)27/h2-5,10-11,13-14,25H,6-9,23H2,1H3,(H,24,26) |
| InChIKey | AJJFJLKLQCDMMD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|