C22H25N3O6S — CID 57026545
1-amino-4-[[4-(2-hydroxyethylamino)cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 57026545) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is 1-amino-4-[[4-(2-hydroxyethylamino)cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[[4-(2-hydroxyethylamino)cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 57026545 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 1-amino-4-[[4-(2-hydroxyethylamino)cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(NC2CCC(NCCO)CC2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H25N3O6S/c23-20-17(32(29,30)31)11-16(25-13-7-5-12(6-8-13)24-9-10-26)18-19(20)22(28)15-4-2-1-3-14(15)21(18)27/h1-4,11-13,24-26H,5-10,23H2,(H,29,30,31) |
| InChIKey | HYEUXZAXNKUPPI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|