C27H27N3O7S2 — CID 3023216
1-amino-4-[[4-[(4-methylphenyl)sulfonylamino]cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 3023216) has the molecular formula C27H27N3O7S2 and a molecular weight of 569.66 g/mol. Its IUPAC name is 1-amino-4-[[4-[(4-methylphenyl)sulfonylamino]cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[[4-[(4-methylphenyl)sulfonylamino]cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 3023216 |
| Molecular Formula | C27H27N3O7S2 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 1-amino-4-[[4-[(4-methylphenyl)sulfonylamino]cyclohexyl]amino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCC(Nc3cc(S(=O)(=O)O)c(N)c4c3C(=O)c3ccccc3C4=O)CC2)cc1 |
| InChI | InChI=1S/C27H27N3O7S2/c1-15-6-12-18(13-7-15)38(33,34)30-17-10-8-16(9-11-17)29-21-14-22(39(35,36)37)25(28)24-23(21)26(31)19-4-2-3-5-20(19)27(24)32/h2-7,12-14,16-17,29-30H,8-11,28H2,1H3,(H,35,36,37) |
| InChIKey | GZWZMRKMWJEDQP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 172.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|