C18H28N2O4 — CID 118536573
tert-butyl 2-[[(2S)-2-amino-3-phenylpropanoyl]-hydroxyamino]-3-methylbutanoate (PubChem CID 118536573) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-2-amino-3-phenylpropanoyl]-hydroxyamino]-3-methylbutanoate.
| Compound Name | tert-butyl 2-[[(2S)-2-amino-3-phenylpropanoyl]-hydroxyamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118536573 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl 2-[[(2S)-2-amino-3-phenylpropanoyl]-hydroxyamino]-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OC(C)(C)C)N(O)C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C18H28N2O4/c1-12(2)15(17(22)24-18(3,4)5)20(23)16(21)14(19)11-13-9-7-6-8-10-13/h6-10,12,14-15,23H,11,19H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | AHSQZQHMEMIRIS-MLCCFXAWSA-N |
| XLogP | 2.14 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|