C22H28N4O4 — CID 56618724
1,2-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione (PubChem CID 56618724) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1,2-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | 1,2-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 56618724 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1,2-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(NCCNCCO)c2NCCNCCO |
| InChI | InChI=1S/C22H28N4O4/c27-13-11-23-7-9-25-18-6-5-17-19(20(18)26-10-8-24-12-14-28)22(30)16-4-2-1-3-15(16)21(17)29/h1-6,23-28H,7-14H2 |
| InChIKey | QWQODXOOURACDQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|