C20H14O8 — CID 10385215
2-(1,4-diacetyloxy-9,10-dioxoanthracen-2-yl)acetic acid (PubChem CID 10385215) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is 2-(1,4-diacetyloxy-9,10-dioxoanthracen-2-yl)acetic acid.
| Compound Name | 2-(1,4-diacetyloxy-9,10-dioxoanthracen-2-yl)acetic acid |
|---|---|
| PubChem CID | 10385215 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(1,4-diacetyloxy-9,10-dioxoanthracen-2-yl)acetic acid |
| SMILES | CC(=O)Oc1cc(CC(=O)O)c(OC(C)=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H14O8/c1-9(21)27-14-7-11(8-15(23)24)20(28-10(2)22)17-16(14)18(25)12-5-3-4-6-13(12)19(17)26/h3-7H,8H2,1-2H3,(H,23,24) |
| InChIKey | OLEZLSSTFDNLEL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|