C27H26O9 — CID 132768427
[3-(1,3-diacetyloxybutyl)-9,10-dioxo-4-(2-oxopropyl)anthracen-1-yl] acetate (PubChem CID 132768427) has the molecular formula C27H26O9 and a molecular weight of 494.50 g/mol. Its IUPAC name is [3-(1,3-diacetyloxybutyl)-9,10-dioxo-4-(2-oxopropyl)anthracen-1-yl] acetate.
| Compound Name | [3-(1,3-diacetyloxybutyl)-9,10-dioxo-4-(2-oxopropyl)anthracen-1-yl] acetate |
|---|---|
| PubChem CID | 132768427 |
| Molecular Formula | C27H26O9 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [3-(1,3-diacetyloxybutyl)-9,10-dioxo-4-(2-oxopropyl)anthracen-1-yl] acetate |
| SMILES | CC(=O)Cc1c(C(CC(C)OC(C)=O)OC(C)=O)cc(OC(C)=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H26O9/c1-13(28)10-21-20(22(35-16(4)30)11-14(2)34-15(3)29)12-23(36-17(5)31)25-24(21)26(32)18-8-6-7-9-19(18)27(25)33/h6-9,12,14,22H,10-11H2,1-5H3 |
| InChIKey | GDFZCYBIXRSHDK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|