C15H20O5 — CID 134966639
[(2R,4S)-4-acetyloxy-4-(4-methoxyphenyl)butan-2-yl] acetate (PubChem CID 134966639) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(2R,4S)-4-acetyloxy-4-(4-methoxyphenyl)butan-2-yl] acetate.
| Compound Name | [(2R,4S)-4-acetyloxy-4-(4-methoxyphenyl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 134966639 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(2R,4S)-4-acetyloxy-4-(4-methoxyphenyl)butan-2-yl] acetate |
| SMILES | COc1ccc([C@H](C[C@@H](C)OC(C)=O)OC(C)=O)cc1 |
| InChI | InChI=1S/C15H20O5/c1-10(19-11(2)16)9-15(20-12(3)17)13-5-7-14(18-4)8-6-13/h5-8,10,15H,9H2,1-4H3/t10-,15+/m1/s1 |
| InChIKey | PXAVMHXPHDCHPK-BMIGLBTASA-N |
| XLogP | 2.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |