About CID 168763649
CID 168763649 (PubChem CID 168763649) has the molecular formula C11H13O3
and a molecular weight of 193.22 g/mol.
Molecular Properties
| Compound Name | CID 168763649 |
| PubChem CID | 168763649 |
| Molecular Formula | C11H13O3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | — |
| SMILES | [CH2]C(OC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H13O3/c1-8(14-9(2)12)10-4-6-11(13-3)7-5-10/h4-8H,1H2,2-3H3 |
| InChIKey | QAONFPSMFQOISS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 168763649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168763649?
The IUPAC name of CID 168763649 (CID 168763649) is not available.
What is the SMILES notation for CID 168763649?
The canonical SMILES for CID 168763649 is [CH2]C(OC(C)=O)c1ccc(OC)cc1.
What is the InChIKey of CID 168763649?
The InChIKey is QAONFPSMFQOISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O3/c1-8(14-9(2)12)10-4-6-11(13-3)7-5-10/h4-8H,1H2,2-3H3.
What are the key properties of CID 168763649?
CID 168763649 has a molecular weight of 193.22 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168763649 is sourced from PubChem (CID 168763649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).