C24H26O6 — CID 142627071
1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)octyl acetate (PubChem CID 142627071) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)octyl acetate.
| Compound Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)octyl acetate |
|---|---|
| PubChem CID | 142627071 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)octyl acetate |
| SMILES | CCCCCCCC(OC(C)=O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H26O6/c1-3-4-5-6-7-12-19(30-14(2)25)17-13-18(26)20-21(24(17)29)23(28)16-11-9-8-10-15(16)22(20)27/h8-11,13,19,26,29H,3-7,12H2,1-2H3 |
| InChIKey | JVOIHFSHJTUGFX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|