C53H59ClN2O12 — CID 10056716
[11-(4-aminocyclohexanecarbonyl)oxy-1,11-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)undecyl] 4-aminocyclohexane-1-carboxylate;hydrochloride (PubChem CID 10056716) has the molecular formula C53H59ClN2O12 and a molecular weight of 951.51 g/mol. Its IUPAC name is [11-(4-aminocyclohexanecarbonyl)oxy-1,11-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)undecyl] 4-aminocyclohexane-1-carboxylate;hydrochloride.
| Compound Name | [11-(4-aminocyclohexanecarbonyl)oxy-1,11-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)undecyl] 4-aminocyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 10056716 |
| Molecular Formula | C53H59ClN2O12 |
| Molecular Weight | 951.51 g/mol |
| Exact Mass | 950.38 |
| IUPAC Name | [11-(4-aminocyclohexanecarbonyl)oxy-1,11-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)undecyl] 4-aminocyclohexane-1-carboxylate;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)OC(CCCCCCCCCC(OC(=O)C2CCC(N)CC2)c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C53H58N2O12.ClH/c54-30-22-18-28(19-23-30)52(64)66-40(36-26-38(56)42-44(50(36)62)48(60)34-14-10-8-12-32(34)46(42)58)16-6-4-2-1-3-5-7-17-41(67-53(65)29-20-24-31(55)25-21-29)37-27-39(57)43-45(51(37)63)49(61)35-15-11-9-13-33(35)47(43)59;/h8-15,26-31,40-41,56-57,62-63H,1-7,16-25,54-55H2;1H |
| InChIKey | ISJRZEYYSIMURJ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 253.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.51 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|