C47H48N2O12+2 — CID 134972397
[4-[5-(4-azaniumylcyclohexanecarbonyl)oxy-1,5-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)pentoxy]carbonylcyclohexyl]azanium (PubChem CID 134972397) has the molecular formula C47H48N2O12+2 and a molecular weight of 832.90 g/mol. Its IUPAC name is [4-[5-(4-azaniumylcyclohexanecarbonyl)oxy-1,5-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)pentoxy]carbonylcyclohexyl]azanium.
| Compound Name | [4-[5-(4-azaniumylcyclohexanecarbonyl)oxy-1,5-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)pentoxy]carbonylcyclohexyl]azanium |
|---|---|
| PubChem CID | 134972397 |
| Molecular Formula | C47H48N2O12+2 |
| Molecular Weight | 832.90 g/mol |
| Exact Mass | 832.32 |
| IUPAC Name | [4-[5-(4-azaniumylcyclohexanecarbonyl)oxy-1,5-bis(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)pentoxy]carbonylcyclohexyl]azanium |
| SMILES | [NH3+]C1CCC(C(=O)OC(CCCC(OC(=O)C2CCC([NH3+])CC2)c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C47H46N2O12/c48-24-16-12-22(13-17-24)46(58)60-34(30-20-32(50)36-38(44(30)56)42(54)28-8-3-1-6-26(28)40(36)52)10-5-11-35(61-47(59)23-14-18-25(49)19-15-23)31-21-33(51)37-39(45(31)57)43(55)29-9-4-2-7-27(29)41(37)53/h1-4,6-9,20-25,34-35,50-51,56-57H,5,10-19,48-49H2/p+2 |
| InChIKey | GQFHUMMRCIWACH-UHFFFAOYSA-P |
| XLogP | 4.70 |
| TPSA | 257.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.90 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|