C23H22FNO6 — CID 10434560
1-(6-fluoro-1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-aminocyclohexane-1-carboxylate (PubChem CID 10434560) has the molecular formula C23H22FNO6 and a molecular weight of 427.43 g/mol. Its IUPAC name is 1-(6-fluoro-1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-aminocyclohexane-1-carboxylate.
| Compound Name | 1-(6-fluoro-1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-aminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10434560 |
| Molecular Formula | C23H22FNO6 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-(6-fluoro-1,4-dihydroxy-9,10-dioxoanthracen-2-yl)ethyl 4-aminocyclohexane-1-carboxylate |
| SMILES | CC(OC(=O)C1CCC(N)CC1)c1cc(O)c2c(c1O)C(=O)c1ccc(F)cc1C2=O |
| InChI | InChI=1S/C23H22FNO6/c1-10(31-23(30)11-2-5-13(25)6-3-11)15-9-17(26)18-19(21(15)28)20(27)14-7-4-12(24)8-16(14)22(18)29/h4,7-11,13,26,28H,2-3,5-6,25H2,1H3 |
| InChIKey | XBVCCWHSIFONRE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|