C20H18O6 — CID 15360689
1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butyl acetate (PubChem CID 15360689) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butyl acetate.
| Compound Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butyl acetate |
|---|---|
| PubChem CID | 15360689 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butyl acetate |
| SMILES | CCCC(OC(C)=O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H18O6/c1-3-6-15(26-10(2)21)13-9-14(22)16-17(20(13)25)19(24)12-8-5-4-7-11(12)18(16)23/h4-5,7-9,15,22,25H,3,6H2,1-2H3 |
| InChIKey | PCZJXGNJJGSLJJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|