C19H16O6 — CID 15360688
1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propyl acetate (PubChem CID 15360688) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propyl acetate.
| Compound Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propyl acetate |
|---|---|
| PubChem CID | 15360688 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propyl acetate |
| SMILES | CCC(OC(C)=O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H16O6/c1-3-14(25-9(2)20)12-8-13(21)15-16(19(12)24)18(23)11-7-5-4-6-10(11)17(15)22/h4-8,14,21,24H,3H2,1-2H3 |
| InChIKey | QORDIWXXZBPXOQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|