C19H18O6 — CID 70538412
2-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanoic acid;ethane (PubChem CID 70538412) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanoic acid;ethane.
| Compound Name | 2-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 70538412 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanoic acid;ethane |
| SMILES | CC.CC(C(=O)O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H12O6.C2H6/c1-7(17(22)23)10-6-11(18)12-13(16(10)21)15(20)9-5-3-2-4-8(9)14(12)19;1-2/h2-7,18,21H,1H3,(H,22,23);1-2H3 |
| InChIKey | AECCQLYGRJJDMV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|