C20H18O6 — CID 155468795
2-[(2R)-2-ethyl-2-hydroxy-3-oxobutyl]-1,4-dihydroxyanthracene-9,10-dione (PubChem CID 155468795) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[(2R)-2-ethyl-2-hydroxy-3-oxobutyl]-1,4-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-[(2R)-2-ethyl-2-hydroxy-3-oxobutyl]-1,4-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 155468795 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[(2R)-2-ethyl-2-hydroxy-3-oxobutyl]-1,4-dihydroxyanthracene-9,10-dione |
| SMILES | CC[C@@](O)(Cc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O)C(C)=O |
| InChI | InChI=1S/C20H18O6/c1-3-20(26,10(2)21)9-11-8-14(22)15-16(17(11)23)19(25)13-7-5-4-6-12(13)18(15)24/h4-8,22-23,26H,3,9H2,1-2H3/t20-/m1/s1 |
| InChIKey | HLNGBWRXDJDAGB-HXUWFJFHSA-N |
| XLogP | 2.15 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|