C18H14O7 — CID 95931027
methyl 2-(1,4-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)acetate (PubChem CID 95931027) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is methyl 2-(1,4-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)acetate.
| Compound Name | methyl 2-(1,4-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)acetate |
|---|---|
| PubChem CID | 95931027 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl 2-(1,4-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)acetate |
| SMILES | COC(=O)Cc1cc(O)c2c(c1O)C(=O)c1cccc(OC)c1C2=O |
| InChI | InChI=1S/C18H14O7/c1-24-11-5-3-4-9-13(11)18(23)14-10(19)6-8(7-12(20)25-2)16(21)15(14)17(9)22/h3-6,19,21H,7H2,1-2H3 |
| InChIKey | AACMDEASTGHXOY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|